C6H10BN4O2 — CID 91064123
CID 91064123 (PubChem CID 91064123) has the molecular formula C6H10BN4O2 and a molecular weight of 180.98 g/mol.
| Compound Name | CID 91064123 |
|---|---|
| PubChem CID | 91064123 |
| Molecular Formula | C6H10BN4O2 |
| Molecular Weight | 180.98 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | — |
| SMILES | Cc1nn(C)cc1C(=O)NN[B]O |
| InChI | InChI=1S/C6H10BN4O2/c1-4-5(3-11(2)9-4)6(12)8-10-7-13/h3,10,13H,1-2H3,(H,8,12) |
| InChIKey | PPEZZFGGRSCCKD-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.98 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|