C12H16ClFN4O — CID 91065503
7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-hydroxy-3-methylheptanenitrile (PubChem CID 91065503) has the molecular formula C12H16ClFN4O and a molecular weight of 286.74 g/mol. Its IUPAC name is 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-hydroxy-3-methylheptanenitrile.
| Compound Name | 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-hydroxy-3-methylheptanenitrile |
|---|---|
| PubChem CID | 91065503 |
| Molecular Formula | C12H16ClFN4O |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 7-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-hydroxy-3-methylheptanenitrile |
| SMILES | CC(O)(CC#N)CCCCNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C12H16ClFN4O/c1-12(19,5-6-15)4-2-3-7-16-10-9(14)8-17-11(13)18-10/h8,19H,2-5,7H2,1H3,(H,16,17,18) |
| InChIKey | PPEVWOKYWLMMJZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|