C19H23NO7S — CID 91070475
1-[2-[(7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl)sulfanyl]ethyl]pyrrole-2,5-diol (PubChem CID 91070475) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[2-[(7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl)sulfanyl]ethyl]pyrrole-2,5-diol.
| Compound Name | 1-[2-[(7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl)sulfanyl]ethyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91070475 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-[2-[(7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl)sulfanyl]ethyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCSC1OC2COC(c3ccccc3)OC2C(O)C1O |
| InChI | InChI=1S/C19H23NO7S/c21-13-6-7-14(22)20(13)8-9-28-19-16(24)15(23)17-12(26-19)10-25-18(27-17)11-4-2-1-3-5-11/h1-7,12,15-19,21-24H,8-10H2 |
| InChIKey | JPFTZCCALLMHFZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |