About (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole
(3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole (PubChem CID 91072407) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole.
Analyze (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole?
The IUPAC name of (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole (CID 91072407) is (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole.
What is the SMILES notation for (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole?
The canonical SMILES for (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole is C[C@H]1CC(C(C)(C)C)=NN1C.
What is the InChIKey of (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole?
The InChIKey is JWFUMZMSGMNTFB-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H18N2/c1-7-6-8(9(2,3)4)10-11(7)5/h7H,6H2,1-5H3/t7-/m0/s1.
What are the key properties of (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole?
(3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole has a molecular weight of 154.26 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-tert-butyl-2,3-dimethyl-3,4-dihydropyrazole is sourced from PubChem (CID 91072407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).