About 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole
5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole (PubChem CID 155347942) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole.
Analyze 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole?
The IUPAC name of 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole (CID 155347942) is 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole?
The canonical SMILES for 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole is CC/C=C\C1=NN(C)C(C)C1.
What is the InChIKey of 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole?
The InChIKey is ZIHVCVLHLNFREI-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-5-6-9-7-8(2)11(3)10-9/h5-6,8H,4,7H2,1-3H3/b6-5-.
What are the key properties of 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole?
5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole has a molecular weight of 152.24 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-2,3-dimethyl-3,4-dihydropyrazole is sourced from PubChem (CID 155347942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).