C20H19N3O3S — CID 9107349
methyl (2S)-4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 9107349) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is methyl (2S)-4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | methyl (2S)-4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 9107349 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | methyl (2S)-4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(c2ncnc3sc4c(c23)CCCC4)c2ccccc2O1 |
| InChI | InChI=1S/C20H19N3O3S/c1-25-20(24)15-10-23(13-7-3-4-8-14(13)26-15)18-17-12-6-2-5-9-16(12)27-19(17)22-11-21-18/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | UUHLSRBLBZLRJH-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |