C13H14N2O2 — CID 91074149
N-[3-(2-oxo-3,4-dihydropyridin-1-yl)phenyl]acetamide (PubChem CID 91074149) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[3-(2-oxo-3,4-dihydropyridin-1-yl)phenyl]acetamide.
| Compound Name | N-[3-(2-oxo-3,4-dihydropyridin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91074149 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-[3-(2-oxo-3,4-dihydropyridin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N2C=CCCC2=O)c1 |
| InChI | InChI=1S/C13H14N2O2/c1-10(16)14-11-5-4-6-12(9-11)15-8-3-2-7-13(15)17/h3-6,8-9H,2,7H2,1H3,(H,14,16) |
| InChIKey | SJZQBJFEEULCBA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |