C15H22BrN3O3 — CID 91077200
methyl N-[(2S,3S)-1-[2-[(4-bromophenyl)methyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 91077200) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is methyl N-[(2S,3S)-1-[2-[(4-bromophenyl)methyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3S)-1-[2-[(4-bromophenyl)methyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 91077200 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | methyl N-[(2S,3S)-1-[2-[(4-bromophenyl)methyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC)C(=O)NNCc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrN3O3/c1-4-10(2)13(18-15(21)22-3)14(20)19-17-9-11-5-7-12(16)8-6-11/h5-8,10,13,17H,4,9H2,1-3H3,(H,18,21)(H,19,20)/t10-,13-/m0/s1 |
| InChIKey | GLXPQWPCGSGAIR-GWCFXTLKSA-N |
| XLogP | 2.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|