C18H44N4O5 — CID 91078542
3-(2-aminoethylamino)-1-ethoxypropan-1-ol;1-(2-aminoethylamino)-3-(1-propan-2-yloxypropan-2-yloxy)propan-1-ol (PubChem CID 91078542) has the molecular formula C18H44N4O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 3-(2-aminoethylamino)-1-ethoxypropan-1-ol;1-(2-aminoethylamino)-3-(1-propan-2-yloxypropan-2-yloxy)propan-1-ol.
| Compound Name | 3-(2-aminoethylamino)-1-ethoxypropan-1-ol;1-(2-aminoethylamino)-3-(1-propan-2-yloxypropan-2-yloxy)propan-1-ol |
|---|---|
| PubChem CID | 91078542 |
| Molecular Formula | C18H44N4O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.33 |
| IUPAC Name | 3-(2-aminoethylamino)-1-ethoxypropan-1-ol;1-(2-aminoethylamino)-3-(1-propan-2-yloxypropan-2-yloxy)propan-1-ol |
| SMILES | CC(C)OCC(C)OCCC(O)NCCN.CCOC(O)CCNCCN |
| InChI | InChI=1S/C11H26N2O3.C7H18N2O2/c1-9(2)16-8-10(3)15-7-4-11(14)13-6-5-12;1-2-11-7(10)3-5-9-6-4-8/h9-11,13-14H,4-8,12H2,1-3H3;7,9-10H,2-6,8H2,1H3 |
| InChIKey | GZARKXSDQONUGK-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|