C22H27N3O3S — CID 91080810
N-[(2S)-4-hydrazinyl-1-phenylmethoxybutan-2-yl]-4-methylnaphthalene-1-sulfonamide (PubChem CID 91080810) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[(2S)-4-hydrazinyl-1-phenylmethoxybutan-2-yl]-4-methylnaphthalene-1-sulfonamide.
| Compound Name | N-[(2S)-4-hydrazinyl-1-phenylmethoxybutan-2-yl]-4-methylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 91080810 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[(2S)-4-hydrazinyl-1-phenylmethoxybutan-2-yl]-4-methylnaphthalene-1-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCNN)COCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H27N3O3S/c1-17-11-12-22(21-10-6-5-9-20(17)21)29(26,27)25-19(13-14-24-23)16-28-15-18-7-3-2-4-8-18/h2-12,19,24-25H,13-16,23H2,1H3/t19-/m0/s1 |
| InChIKey | HDCCWWFEULBTMS-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|