C25H29F3N4O5S — CID 161320589
2-[(2S)-2-[(4-methylnaphthalen-1-yl)sulfonylamino]-4-phenylmethoxybutyl]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 161320589) has the molecular formula C25H29F3N4O5S and a molecular weight of 554.59 g/mol. Its IUPAC name is 2-[(2S)-2-[(4-methylnaphthalen-1-yl)sulfonylamino]-4-phenylmethoxybutyl]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2S)-2-[(4-methylnaphthalen-1-yl)sulfonylamino]-4-phenylmethoxybutyl]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161320589 |
| Molecular Formula | C25H29F3N4O5S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 2-[(2S)-2-[(4-methylnaphthalen-1-yl)sulfonylamino]-4-phenylmethoxybutyl]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCOCc2ccccc2)CN=C(N)N)c2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28N4O3S.C2HF3O2/c1-17-11-12-22(21-10-6-5-9-20(17)21)31(28,29)27-19(15-26-23(24)25)13-14-30-16-18-7-3-2-4-8-18;3-2(4,5)1(6)7/h2-12,19,27H,13-16H2,1H3,(H4,24,25,26);(H,6,7)/t19-;/m0./s1 |
| InChIKey | VKBXOASHMBPORD-FYZYNONXSA-N |
| XLogP | 3.31 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|