C16H27N3O6 — CID 91080963
(2,5-dihydroxypyrrol-1-yl) 5-[2-aminoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (PubChem CID 91080963) has the molecular formula C16H27N3O6 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-[2-aminoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-[2-aminoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 91080963 |
| Molecular Formula | C16H27N3O6 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-[2-aminoethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N(CCN)CCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H27N3O6/c1-16(2,3)24-15(23)18(11-9-17)10-5-4-6-14(22)25-19-12(20)7-8-13(19)21/h7-8,20-21H,4-6,9-11,17H2,1-3H3 |
| InChIKey | MSOMJZJOAJNTRK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|