C13H16BrN — CID 91083457
6-(bromomethyl)-7,10-dimethyl-8,9-dihydropyrido[1,2-a]azepine (PubChem CID 91083457) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is 6-(bromomethyl)-7,10-dimethyl-8,9-dihydropyrido[1,2-a]azepine.
| Compound Name | 6-(bromomethyl)-7,10-dimethyl-8,9-dihydropyrido[1,2-a]azepine |
|---|---|
| PubChem CID | 91083457 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-(bromomethyl)-7,10-dimethyl-8,9-dihydropyrido[1,2-a]azepine |
| SMILES | CC1=C2C=CC=CN2C(CBr)=C(C)CC1 |
| InChI | InChI=1S/C13H16BrN/c1-10-6-7-11(2)13(9-14)15-8-4-3-5-12(10)15/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | KBHYTFCZTDMJFE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|