About [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine
[3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine (PubChem CID 91084845) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine |
| PubChem CID | 91084845 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine |
| SMILES | NCC1CCCC(CN)(CC2CO2)C1CC1CO1 |
| InChI | InChI=1S/C14H26N2O2/c15-6-10-2-1-3-14(9-16,5-12-8-18-12)13(10)4-11-7-17-11/h10-13H,1-9,15-16H2 |
| InChIKey | CJRYFQHZLXDTQJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine?
The IUPAC name of [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine (CID 91084845) is [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine.
What is the SMILES notation for [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine?
The canonical SMILES for [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine is NCC1CCCC(CN)(CC2CO2)C1CC1CO1.
What is the InChIKey of [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine?
The InChIKey is CJRYFQHZLXDTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c15-6-10-2-1-3-14(9-16,5-12-8-18-12)13(10)4-11-7-17-11/h10-13H,1-9,15-16H2.
What are the key properties of [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine?
[3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine has a molecular weight of 254.37 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine is sourced from PubChem (CID 91084845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).