C14H26N2O2 — CID 91084845
[3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine (PubChem CID 91084845) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine.
| Compound Name | [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 91084845 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | [3-(aminomethyl)-2,3-bis(oxiran-2-ylmethyl)cyclohexyl]methanamine |
| SMILES | NCC1CCCC(CN)(CC2CO2)C1CC1CO1 |
| InChI | InChI=1S/C14H26N2O2/c15-6-10-2-1-3-14(9-16,5-12-8-18-12)13(10)4-11-7-17-11/h10-13H,1-9,15-16H2 |
| InChIKey | CJRYFQHZLXDTQJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|