About 3-chloroprop-2-ynyl propanoate
3-chloroprop-2-ynyl propanoate (PubChem CID 91086083) has the molecular formula C6H7ClO2
and a molecular weight of 146.57 g/mol. Its IUPAC name is 3-chloroprop-2-ynyl propanoate.
Molecular Properties
| Compound Name | 3-chloroprop-2-ynyl propanoate |
| PubChem CID | 91086083 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | 3-chloroprop-2-ynyl propanoate |
| SMILES | CCC(=O)OCC#CCl |
| InChI | InChI=1S/C6H7ClO2/c1-2-6(8)9-5-3-4-7/h2,5H2,1H3 |
| InChIKey | KCSDBSODKJUCFY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroprop-2-ynyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroprop-2-ynyl propanoate?
The IUPAC name of 3-chloroprop-2-ynyl propanoate (CID 91086083) is 3-chloroprop-2-ynyl propanoate.
What is the SMILES notation for 3-chloroprop-2-ynyl propanoate?
The canonical SMILES for 3-chloroprop-2-ynyl propanoate is CCC(=O)OCC#CCl.
What is the InChIKey of 3-chloroprop-2-ynyl propanoate?
The InChIKey is KCSDBSODKJUCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO2/c1-2-6(8)9-5-3-4-7/h2,5H2,1H3.
What are the key properties of 3-chloroprop-2-ynyl propanoate?
3-chloroprop-2-ynyl propanoate has a molecular weight of 146.57 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroprop-2-ynyl propanoate is sourced from PubChem (CID 91086083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).