C21H29NO3S — CID 91086195
(Z)-1-[5-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]thiophen-2-yl]-N-methoxymethanimine;ethane (PubChem CID 91086195) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is (Z)-1-[5-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]thiophen-2-yl]-N-methoxymethanimine;ethane.
| Compound Name | (Z)-1-[5-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]thiophen-2-yl]-N-methoxymethanimine;ethane |
|---|---|
| PubChem CID | 91086195 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (Z)-1-[5-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]thiophen-2-yl]-N-methoxymethanimine;ethane |
| SMILES | C/C=C/COc1cc(C)c(OCc2ccc(/C=N\OC)s2)c(C)c1.CC |
| InChI | InChI=1S/C19H23NO3S.C2H6/c1-5-6-9-22-16-10-14(2)19(15(3)11-16)23-13-18-8-7-17(24-18)12-20-21-4;1-2/h5-8,10-12H,9,13H2,1-4H3;1-2H3/b6-5+,20-12-; |
| InChIKey | BJKXYVYFFWJKKJ-ZDLVRJRMSA-N |
| XLogP | 5.91 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|