C20H28N2O3S — CID 91507218
(Z)-1-[2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-4-yl]-N-methoxymethanimine;ethane (PubChem CID 91507218) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is (Z)-1-[2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-4-yl]-N-methoxymethanimine;ethane.
| Compound Name | (Z)-1-[2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-4-yl]-N-methoxymethanimine;ethane |
|---|---|
| PubChem CID | 91507218 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (Z)-1-[2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-4-yl]-N-methoxymethanimine;ethane |
| SMILES | C/C=C/COc1cc(C)c(OCc2nc(/C=N\OC)cs2)c(C)c1.CC |
| InChI | InChI=1S/C18H22N2O3S.C2H6/c1-5-6-7-22-16-8-13(2)18(14(3)9-16)23-11-17-20-15(12-24-17)10-19-21-4;1-2/h5-6,8-10,12H,7,11H2,1-4H3;1-2H3/b6-5+,19-10-; |
| InChIKey | JPYSSOCJLVKQNJ-JXQITDSSSA-N |
| XLogP | 5.30 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|