About ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate
ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate (PubChem CID 91086415) has the molecular formula C23H48N4O2S
and a molecular weight of 444.73 g/mol. Its IUPAC name is ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate.
Molecular Properties
| Compound Name | ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate |
| PubChem CID | 91086415 |
| Molecular Formula | C23H48N4O2S |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate |
| SMILES | CC.CC.CC.CN1CCN(OS(C)=O)CC1.CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C11H16N2.C6H14N2O2S.3C2H6/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11;1-7-3-5-8(6-4-7)10-11(2)9;3*1-2/h2-6H,7-10H2,1H3;3-6H2,1-2H3;3*1-2H3 |
| InChIKey | PWJIAHVDKXGQFQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate?
The IUPAC name of ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate (CID 91086415) is ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate.
What is the SMILES notation for ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate?
The canonical SMILES for ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate is CC.CC.CC.CN1CCN(OS(C)=O)CC1.CN1CCN(c2ccccc2)CC1.
What is the InChIKey of ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate?
The InChIKey is PWJIAHVDKXGQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C6H14N2O2S.3C2H6/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11;1-7-3-5-8(6-4-7)10-11(2)9;3*1-2/h2-6H,7-10H2,1H3;3-6H2,1-2H3;3*1-2H3.
What are the key properties of ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate?
ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate has a molecular weight of 444.73 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-phenylpiperazine;(4-methylpiperazin-1-yl) methanesulfinate is sourced from PubChem (CID 91086415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).