C8H9N — CID 91089129
5-methyl-2,3-dimethylidenepyridine (PubChem CID 91089129) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is 5-methyl-2,3-dimethylidenepyridine.
| Compound Name | 5-methyl-2,3-dimethylidenepyridine |
|---|---|
| PubChem CID | 91089129 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5-methyl-2,3-dimethylidenepyridine |
| SMILES | C=c1cc(C)cnc1=C |
| InChI | InChI=1S/C8H9N/c1-6-4-7(2)8(3)9-5-6/h4-5H,2-3H2,1H3 |
| InChIKey | VGPSRJOJCYPOKD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |