C36H30F6O10 — CID 91090132
methyl 2,3-dimethyl-4-[4-(trifluoromethoxy)benzoyl]oxybenzoate (PubChem CID 91090132) has the molecular formula C36H30F6O10 and a molecular weight of 736.61 g/mol. Its IUPAC name is methyl 2,3-dimethyl-4-[4-(trifluoromethoxy)benzoyl]oxybenzoate.
| Compound Name | methyl 2,3-dimethyl-4-[4-(trifluoromethoxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 91090132 |
| Molecular Formula | C36H30F6O10 |
| Molecular Weight | 736.61 g/mol |
| Exact Mass | 736.17 |
| IUPAC Name | methyl 2,3-dimethyl-4-[4-(trifluoromethoxy)benzoyl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccc(OC(F)(F)F)cc2)c(C)c1C.COC(=O)c1ccc(OC(=O)c2ccc(OC(F)(F)F)cc2)c(C)c1C |
| InChI | InChI=1S/2C18H15F3O5/c2*1-10-11(2)15(9-8-14(10)17(23)24-3)25-16(22)12-4-6-13(7-5-12)26-18(19,20)21/h2*4-9H,1-3H3 |
| InChIKey | OTSWSSHZODVBMQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.61 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|