C25H33N3 — CID 91090429
ethane;4-[5-(1-ethylpiperidin-4-yl)-1-methyl-2-phenylpyrrol-3-yl]pyridine (PubChem CID 91090429) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is ethane;4-[5-(1-ethylpiperidin-4-yl)-1-methyl-2-phenylpyrrol-3-yl]pyridine.
| Compound Name | ethane;4-[5-(1-ethylpiperidin-4-yl)-1-methyl-2-phenylpyrrol-3-yl]pyridine |
|---|---|
| PubChem CID | 91090429 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | ethane;4-[5-(1-ethylpiperidin-4-yl)-1-methyl-2-phenylpyrrol-3-yl]pyridine |
| SMILES | CC.CCN1CCC(c2cc(-c3ccncc3)c(-c3ccccc3)n2C)CC1 |
| InChI | InChI=1S/C23H27N3.C2H6/c1-3-26-15-11-19(12-16-26)22-17-21(18-9-13-24-14-10-18)23(25(22)2)20-7-5-4-6-8-20;1-2/h4-10,13-14,17,19H,3,11-12,15-16H2,1-2H3;1-2H3 |
| InChIKey | ULRKEQPJDLMFQW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |