C21H24N4 — CID 70998364
4-[2-(1-ethylpiperidin-4-yl)-4-phenyl-1H-imidazol-5-yl]pyridine (PubChem CID 70998364) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[2-(1-ethylpiperidin-4-yl)-4-phenyl-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[2-(1-ethylpiperidin-4-yl)-4-phenyl-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 70998364 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 4-[2-(1-ethylpiperidin-4-yl)-4-phenyl-1H-imidazol-5-yl]pyridine |
| SMILES | CCN1CCC(c2nc(-c3ccccc3)c(-c3ccncc3)[nH]2)CC1 |
| InChI | InChI=1S/C21H24N4/c1-2-25-14-10-18(11-15-25)21-23-19(16-6-4-3-5-7-16)20(24-21)17-8-12-22-13-9-17/h3-9,12-13,18H,2,10-11,14-15H2,1H3,(H,23,24) |
| InChIKey | YKQIDNLFHXPWAK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |