C25H21NO4 — CID 91090648
(2R)-3-phenyl-2-[[2-(2-phenyl-1-benzofuran-5-yl)acetyl]amino]propanoic acid (PubChem CID 91090648) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[[2-(2-phenyl-1-benzofuran-5-yl)acetyl]amino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[[2-(2-phenyl-1-benzofuran-5-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91090648 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2R)-3-phenyl-2-[[2-(2-phenyl-1-benzofuran-5-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(Cc1ccc2oc(-c3ccccc3)cc2c1)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H21NO4/c27-24(26-21(25(28)29)14-17-7-3-1-4-8-17)15-18-11-12-22-20(13-18)16-23(30-22)19-9-5-2-6-10-19/h1-13,16,21H,14-15H2,(H,26,27)(H,28,29)/t21-/m1/s1 |
| InChIKey | XLFPKCJYMKJAMZ-OAQYLSRUSA-N |
| XLogP | 4.45 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |