About 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone
1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone (PubChem CID 91091827) has the molecular formula C17H24N2OS
and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone |
| PubChem CID | 91091827 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone |
| SMILES | CCN(CC)c1ccc(C(=O)CN2CSC(C)=C2C)cc1 |
| InChI | InChI=1S/C17H24N2OS/c1-5-18(6-2)16-9-7-15(8-10-16)17(20)11-19-12-21-14(4)13(19)3/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | HRBQKGSSPIPSGV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone?
The IUPAC name of 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone (CID 91091827) is 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone.
What is the SMILES notation for 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone?
The canonical SMILES for 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone is CCN(CC)c1ccc(C(=O)CN2CSC(C)=C2C)cc1.
What is the InChIKey of 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone?
The InChIKey is HRBQKGSSPIPSGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2OS/c1-5-18(6-2)16-9-7-15(8-10-16)17(20)11-19-12-21-14(4)13(19)3/h7-10H,5-6,11-12H2,1-4H3.
What are the key properties of 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone?
1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone has a molecular weight of 304.46 g/mol, XLogP of 3.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(diethylamino)phenyl]-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone is sourced from PubChem (CID 91091827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).