C15H17N3 — CID 91092395
2-(4-ethylidene-5-prop-2-enylidene-1H-imidazol-2-yl)-5-methyl-4H-azepine (PubChem CID 91092395) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(4-ethylidene-5-prop-2-enylidene-1H-imidazol-2-yl)-5-methyl-4H-azepine.
| Compound Name | 2-(4-ethylidene-5-prop-2-enylidene-1H-imidazol-2-yl)-5-methyl-4H-azepine |
|---|---|
| PubChem CID | 91092395 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(4-ethylidene-5-prop-2-enylidene-1H-imidazol-2-yl)-5-methyl-4H-azepine |
| SMILES | C=CC=c1[nH]c(C2=CCC(C)=CC=N2)nc1=CC |
| InChI | InChI=1S/C15H17N3/c1-4-6-13-12(5-2)17-15(18-13)14-8-7-11(3)9-10-16-14/h4-6,8-10H,1,7H2,2-3H3,(H,17,18) |
| InChIKey | CKAFZVQAQFBFPF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |