C16H17N3 — CID 90804757
N-[1-(6-methyl-1,5-dihydrocycloocta[d]imidazol-2-yl)buta-1,3-dienyl]ethanimine (PubChem CID 90804757) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[1-(6-methyl-1,5-dihydrocycloocta[d]imidazol-2-yl)buta-1,3-dienyl]ethanimine.
| Compound Name | N-[1-(6-methyl-1,5-dihydrocycloocta[d]imidazol-2-yl)buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 90804757 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[1-(6-methyl-1,5-dihydrocycloocta[d]imidazol-2-yl)buta-1,3-dienyl]ethanimine |
| SMILES | C=CC=C(/N=C/C)c1nc2c([nH]1)=CC=C=C(C)CC=2 |
| InChI | InChI=1S/C16H17N3/c1-4-7-15(17-5-2)16-18-13-9-6-8-12(3)10-11-14(13)19-16/h4-7,9,11H,1,10H2,2-3H3,(H,18,19)/b13-9?,14-11?,15-7?,17-5+ |
| InChIKey | MBZCNPXRWCDVAW-CTZDVWPTSA-N |
| XLogP | 2.09 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|