C17H25N3 — CID 142874761
ethane;(5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine (PubChem CID 142874761) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is ethane;(5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine.
| Compound Name | ethane;(5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine |
|---|---|
| PubChem CID | 142874761 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | ethane;(5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine |
| SMILES | C=C/C=C(\C=C/C)C1=NC(=N\C=C/C)/C(=C\C)N1.CC |
| InChI | InChI=1S/C15H19N3.C2H6/c1-5-9-12(10-6-2)14-17-13(8-4)15(18-14)16-11-7-3;1-2/h5-11H,1H2,2-4H3,(H,16,17,18);1-2H3/b10-6-,11-7-,12-9+,13-8+; |
| InChIKey | FKOIJJLBOKBRLI-VJGXHREYSA-N |
| XLogP | 4.54 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|