C21H20F3N5O2 — CID 91093947
5,5,5-trifluoro-2-methyl-N-[4-methyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)acetyl]amino]phenyl]pent-2-enamide (PubChem CID 91093947) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-methyl-N-[4-methyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)acetyl]amino]phenyl]pent-2-enamide.
| Compound Name | 5,5,5-trifluoro-2-methyl-N-[4-methyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)acetyl]amino]phenyl]pent-2-enamide |
|---|---|
| PubChem CID | 91093947 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 5,5,5-trifluoro-2-methyl-N-[4-methyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)acetyl]amino]phenyl]pent-2-enamide |
| SMILES | CC(=CCC(F)(F)F)C(=O)Nc1ccc(C)c(NC(=O)Cc2ncnc3[nH]ccc23)c1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-12-3-4-14(28-20(31)13(2)5-7-21(22,23)24)9-16(12)29-18(30)10-17-15-6-8-25-19(15)27-11-26-17/h3-6,8-9,11H,7,10H2,1-2H3,(H,28,31)(H,29,30)(H,25,26,27) |
| InChIKey | AZMHMOJYFOUSRD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|