C29H33N3O8 — CID 91094365
(4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[5-[(propan-2-ylamino)methyl]furan-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91094365) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is (4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[5-[(propan-2-ylamino)methyl]furan-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[5-[(propan-2-ylamino)methyl]furan-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91094365 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | (4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[5-[(propan-2-ylamino)methyl]furan-2-yl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)NCc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)o1 |
| InChI | InChI=1S/C29H33N3O8/c1-12(2)31-11-14-5-8-19(40-14)15-6-7-18(33)21-16(15)9-13-10-17-23(32(3)4)25(35)22(28(30)38)27(37)29(17,39)26(36)20(13)24(21)34/h5-8,12-13,17,20,22-23,31,33,39H,9-11H2,1-4H3,(H2,30,38)/t13-,17-,20?,22?,23?,29-/m0/s1 |
| InChIKey | KYWJHTXXKFJKNJ-WAFLKLABSA-N |
| XLogP | 0.62 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|