C23H25F2N3O8 — CID 91436596
(4S,4aS,5aR,12aS)-7-[(difluoromethoxyamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91436596) has the molecular formula C23H25F2N3O8 and a molecular weight of 509.46 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[(difluoromethoxyamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[(difluoromethoxyamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91436596 |
| Molecular Formula | C23H25F2N3O8 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[(difluoromethoxyamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(CNOC(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C23H25F2N3O8/c1-28(2)16-11-6-9-5-10-8(7-27-36-22(24)25)3-4-12(29)14(10)17(30)13(9)19(32)23(11,35)20(33)15(18(16)31)21(26)34/h3-4,9,11,13,15-16,22,27,29,35H,5-7H2,1-2H3,(H2,26,34)/t9-,11-,13?,15?,16-,23-/m0/s1 |
| InChIKey | VNWJXXMWTDKOJR-HFVWRJSKSA-N |
| XLogP | -0.89 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|