C24H27N3O10 — CID 91511361
2-[[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]methylamino]oxyacetic acid (PubChem CID 91511361) has the molecular formula C24H27N3O10 and a molecular weight of 517.49 g/mol. Its IUPAC name is 2-[[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]methylamino]oxyacetic acid.
| Compound Name | 2-[[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]methylamino]oxyacetic acid |
|---|---|
| PubChem CID | 91511361 |
| Molecular Formula | C24H27N3O10 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-[[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]methylamino]oxyacetic acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(CNOCC(=O)O)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H27N3O10/c1-27(2)18-12-6-10-5-11-9(7-26-37-8-14(29)30)3-4-13(28)16(11)19(31)15(10)21(33)24(12,36)22(34)17(20(18)32)23(25)35/h3-4,10,12,15,17-18,26,28,36H,5-8H2,1-2H3,(H2,25,35)(H,29,30)/t10-,12-,15?,17?,18-,24-/m0/s1 |
| InChIKey | KSZKUTGYKLCSDD-LMTBQXFCSA-N |
| XLogP | -2.03 |
| TPSA | 213.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|