C19H20Cl2N4O3 — CID 91096541
N-[1-amino-2-(4-amino-3,5-dichlorophenyl)ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide (PubChem CID 91096541) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-[1-amino-2-(4-amino-3,5-dichlorophenyl)ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[1-amino-2-(4-amino-3,5-dichlorophenyl)ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 91096541 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[1-amino-2-(4-amino-3,5-dichlorophenyl)ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide |
| SMILES | CON=C(CC(=O)/N=C(\N)Cc1cc(Cl)c(N)c(Cl)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-27-13-5-3-12(4-6-13)16(25-28-2)10-18(26)24-17(22)9-11-7-14(20)19(23)15(21)8-11/h3-8H,9-10,23H2,1-2H3,(H2,22,24,26) |
| InChIKey | YAHXFUDCYBNHIT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|