C38H46N2O13 — CID 91098239
2-[1-[2-[5,12-dihydroxy-7-methoxy-4-(5-morpholin-3-yloxyoxan-2-yl)oxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-2-yl]-2-oxoethoxy]cyclohexyl]oxyacetamide (PubChem CID 91098239) has the molecular formula C38H46N2O13 and a molecular weight of 738.79 g/mol. Its IUPAC name is 2-[1-[2-[5,12-dihydroxy-7-methoxy-4-(5-morpholin-3-yloxyoxan-2-yl)oxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-2-yl]-2-oxoethoxy]cyclohexyl]oxyacetamide.
| Compound Name | 2-[1-[2-[5,12-dihydroxy-7-methoxy-4-(5-morpholin-3-yloxyoxan-2-yl)oxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-2-yl]-2-oxoethoxy]cyclohexyl]oxyacetamide |
|---|---|
| PubChem CID | 91098239 |
| Molecular Formula | C38H46N2O13 |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | 2-[1-[2-[5,12-dihydroxy-7-methoxy-4-(5-morpholin-3-yloxyoxan-2-yl)oxy-6,11-dioxo-1,2,3,4-tetrahydrotetracen-2-yl]-2-oxoethoxy]cyclohexyl]oxyacetamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C(=O)COC1(OCC(N)=O)CCCCC1)CC3OC1CCC(OC2COCCN2)CO1 |
| InChI | InChI=1S/C38H46N2O13/c1-47-25-7-5-6-22-30(25)36(45)33-32(34(22)43)35(44)23-14-20(24(41)17-50-38(51-18-27(39)42)10-3-2-4-11-38)15-26(31(23)37(33)46)53-29-9-8-21(16-49-29)52-28-19-48-13-12-40-28/h5-7,20-21,26,28-29,40,44,46H,2-4,8-19H2,1H3,(H2,39,42) |
| InChIKey | RFJIYDMWDLRLLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 211.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|