C25H22O11 — CID 91098392
4-[5-(3-carboxy-3-phenylpropanoyl)oxy-4,5-dioxopentanoyl]oxy-4-oxo-2-phenylbutanoic acid (PubChem CID 91098392) has the molecular formula C25H22O11 and a molecular weight of 498.44 g/mol. Its IUPAC name is 4-[5-(3-carboxy-3-phenylpropanoyl)oxy-4,5-dioxopentanoyl]oxy-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-[5-(3-carboxy-3-phenylpropanoyl)oxy-4,5-dioxopentanoyl]oxy-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 91098392 |
| Molecular Formula | C25H22O11 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-[5-(3-carboxy-3-phenylpropanoyl)oxy-4,5-dioxopentanoyl]oxy-4-oxo-2-phenylbutanoic acid |
| SMILES | O=C(CCC(=O)C(=O)OC(=O)CC(C(=O)O)c1ccccc1)OC(=O)CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H22O11/c26-19(25(34)36-22(29)14-18(24(32)33)16-9-5-2-6-10-16)11-12-20(27)35-21(28)13-17(23(30)31)15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H,30,31)(H,32,33) |
| InChIKey | SITBZKVTXWERGA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|