C16H14F3NO2 — CID 91102700
6-[4-(trifluoromethoxy)phenoxy]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 91102700) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 6-[4-(trifluoromethoxy)phenoxy]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-[4-(trifluoromethoxy)phenoxy]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 91102700 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-[4-(trifluoromethoxy)phenoxy]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | FC(F)(F)Oc1ccc(Oc2ccc3c(c2)CCNC3)cc1 |
| InChI | InChI=1S/C16H14F3NO2/c17-16(18,19)22-14-5-3-13(4-6-14)21-15-2-1-12-10-20-8-7-11(12)9-15/h1-6,9,20H,7-8,10H2 |
| InChIKey | SDKFIUYXQAOVBA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |