C15H21F3O — CID 91103722
[2-methyl-6-methylidene-4-(2,2,2-trifluoroethoxy)octa-2,4-dienyl]cyclopropane (PubChem CID 91103722) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is [2-methyl-6-methylidene-4-(2,2,2-trifluoroethoxy)octa-2,4-dienyl]cyclopropane.
| Compound Name | [2-methyl-6-methylidene-4-(2,2,2-trifluoroethoxy)octa-2,4-dienyl]cyclopropane |
|---|---|
| PubChem CID | 91103722 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [2-methyl-6-methylidene-4-(2,2,2-trifluoroethoxy)octa-2,4-dienyl]cyclopropane |
| SMILES | C=C(C=C(C=C(C)CC1CC1)OCC(F)(F)F)CC |
| InChI | InChI=1S/C15H21F3O/c1-4-11(2)8-14(19-10-15(16,17)18)9-12(3)7-13-5-6-13/h8-9,13H,2,4-7,10H2,1,3H3 |
| InChIKey | YMXOHEBTUYVWJE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|