C15H22F2O — CID 91198045
4-(2,2-difluoroethoxy)-1-hexan-2-ylcyclohepta-1,3,5-triene (PubChem CID 91198045) has the molecular formula C15H22F2O and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-hexan-2-ylcyclohepta-1,3,5-triene.
| Compound Name | 4-(2,2-difluoroethoxy)-1-hexan-2-ylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 91198045 |
| Molecular Formula | C15H22F2O |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-hexan-2-ylcyclohepta-1,3,5-triene |
| SMILES | CCCCC(C)C1=CC=C(OCC(F)F)C=CC1 |
| InChI | InChI=1S/C15H22F2O/c1-3-4-6-12(2)13-7-5-8-14(10-9-13)18-11-15(16)17/h5,8-10,12,15H,3-4,6-7,11H2,1-2H3 |
| InChIKey | QAERGIBDOXCKSS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |