C19H21N3O2S — CID 9110496
4-[(1S,2S)-1-hydroxy-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]propyl]phenol (PubChem CID 9110496) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[(1S,2S)-1-hydroxy-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]propyl]phenol.
| Compound Name | 4-[(1S,2S)-1-hydroxy-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]propyl]phenol |
|---|---|
| PubChem CID | 9110496 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[(1S,2S)-1-hydroxy-2-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]propyl]phenol |
| SMILES | Cc1nc(N[C@@H](C)[C@@H](O)c2ccc(O)cc2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C19H21N3O2S/c1-10(17(24)12-6-8-13(23)9-7-12)20-18-16-14-4-3-5-15(14)25-19(16)22-11(2)21-18/h6-10,17,23-24H,3-5H2,1-2H3,(H,20,21,22)/t10-,17+/m0/s1 |
| InChIKey | IHCLNKPTUVOKJI-DYZYQPBXSA-N |
| XLogP | 3.73 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |