C17H21N3O4 — CID 9110580
N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitropyridin-2-amine (PubChem CID 9110580) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitropyridin-2-amine.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 9110580 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-nitropyridin-2-amine |
| SMILES | CCOc1ccc(CCNc2ncccc2[N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C17H21N3O4/c1-3-23-15-8-7-13(12-16(15)24-4-2)9-11-19-17-14(20(21)22)6-5-10-18-17/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,18,19) |
| InChIKey | KCNJSLVJIFQYPI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|