C18H24FNO6 — CID 91107658
ethyl 3-(2-fluoro-4,5-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate (PubChem CID 91107658) has the molecular formula C18H24FNO6 and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4,5-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
| Compound Name | ethyl 3-(2-fluoro-4,5-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
|---|---|
| PubChem CID | 91107658 |
| Molecular Formula | C18H24FNO6 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 3-(2-fluoro-4,5-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
| SMILES | CCOC(=O)C(Cc1cc(OC)c(OC)cc1F)=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO6/c1-7-25-16(21)13(20-17(22)26-18(2,3)4)8-11-9-14(23-5)15(24-6)10-12(11)19/h9-10H,7-8H2,1-6H3 |
| InChIKey | BLLRXBCIRFNPFR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|