C28H52N2O2 — CID 91109881
3-(3-ethyl-2,3-dimethylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol (PubChem CID 91109881) has the molecular formula C28H52N2O2 and a molecular weight of 448.74 g/mol. Its IUPAC name is 3-(3-ethyl-2,3-dimethylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol.
| Compound Name | 3-(3-ethyl-2,3-dimethylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91109881 |
| Molecular Formula | C28H52N2O2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.40 |
| IUPAC Name | 3-(3-ethyl-2,3-dimethylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
| SMILES | CCC(C)(CC)c1c(CC(C)C(C)(CC)CC)c(O)n(C2CC(C)(C)NC(C)(C)C2)c1O |
| InChI | InChI=1S/C28H52N2O2/c1-12-27(10,13-2)19(5)16-21-22(28(11,14-3)15-4)24(32)30(23(21)31)20-17-25(6,7)29-26(8,9)18-20/h19-20,29,31-32H,12-18H2,1-11H3 |
| InChIKey | IRTPQBFRVZWKFM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |