C10H7BrF3NO — CID 91110685
5-bromo-2-(2,2,2-trifluoroethyl)isoindol-1-ol (PubChem CID 91110685) has the molecular formula C10H7BrF3NO and a molecular weight of 294.07 g/mol. Its IUPAC name is 5-bromo-2-(2,2,2-trifluoroethyl)isoindol-1-ol.
| Compound Name | 5-bromo-2-(2,2,2-trifluoroethyl)isoindol-1-ol |
|---|---|
| PubChem CID | 91110685 |
| Molecular Formula | C10H7BrF3NO |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 5-bromo-2-(2,2,2-trifluoroethyl)isoindol-1-ol |
| SMILES | Oc1c2ccc(Br)cc2cn1CC(F)(F)F |
| InChI | InChI=1S/C10H7BrF3NO/c11-7-1-2-8-6(3-7)4-15(9(8)16)5-10(12,13)14/h1-4,16H,5H2 |
| InChIKey | LWOTXSZCJKGJQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |