C14H28N2O3S — CID 91110830
4-(6-morpholin-4-ylhexan-2-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 91110830) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-(6-morpholin-4-ylhexan-2-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(6-morpholin-4-ylhexan-2-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 91110830 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-(6-morpholin-4-ylhexan-2-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(CCCCN1CCOCC1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H28N2O3S/c1-14(16-8-12-20(17,18)13-9-16)4-2-3-5-15-6-10-19-11-7-15/h14H,2-13H2,1H3 |
| InChIKey | RHNGTAUTVPLGBB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|