C22H27ClN6O3 — CID 91111346
(4R)-7-chloro-19-methyl-9-oxa-3,16,19,21,23,25-hexazatetracyclo[18.6.1.14,8.024,27]octacosa-2,5,7,20,22,24(27)-hexaene-15,26-dione (PubChem CID 91111346) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is (4R)-7-chloro-19-methyl-9-oxa-3,16,19,21,23,25-hexazatetracyclo[18.6.1.14,8.024,27]octacosa-2,5,7,20,22,24(27)-hexaene-15,26-dione.
| Compound Name | (4R)-7-chloro-19-methyl-9-oxa-3,16,19,21,23,25-hexazatetracyclo[18.6.1.14,8.024,27]octacosa-2,5,7,20,22,24(27)-hexaene-15,26-dione |
|---|---|
| PubChem CID | 91111346 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (4R)-7-chloro-19-methyl-9-oxa-3,16,19,21,23,25-hexazatetracyclo[18.6.1.14,8.024,27]octacosa-2,5,7,20,22,24(27)-hexaene-15,26-dione |
| SMILES | CN1CCNC(=O)CCCCCOC2=C(Cl)C=C[C@@H](C2)/N=C\C2C(=O)Nc3ncnc1c32 |
| InChI | InChI=1S/C22H27ClN6O3/c1-29-9-8-24-18(30)5-3-2-4-10-32-17-11-14(6-7-16(17)23)25-12-15-19-20(28-22(15)31)26-13-27-21(19)29/h6-7,12-15H,2-5,8-11H2,1H3,(H,24,30)(H,26,27,28,31)/b25-12-/t14-,15?/m0/s1 |
| InChIKey | KDOUBXIBSLGWEE-CSKWQMMMSA-N |
| XLogP | 2.51 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |