C24H32N6O4 — CID 91264885
7-methoxy-17-methyl-14-propan-2-yl-9-oxa-3,14,17,19,21,23-hexazatetracyclo[16.6.1.14,8.022,25]hexacosa-2,5,7,18,20,22(25)-hexaene-13,24-dione (PubChem CID 91264885) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is 7-methoxy-17-methyl-14-propan-2-yl-9-oxa-3,14,17,19,21,23-hexazatetracyclo[16.6.1.14,8.022,25]hexacosa-2,5,7,18,20,22(25)-hexaene-13,24-dione.
| Compound Name | 7-methoxy-17-methyl-14-propan-2-yl-9-oxa-3,14,17,19,21,23-hexazatetracyclo[16.6.1.14,8.022,25]hexacosa-2,5,7,18,20,22(25)-hexaene-13,24-dione |
|---|---|
| PubChem CID | 91264885 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 7-methoxy-17-methyl-14-propan-2-yl-9-oxa-3,14,17,19,21,23-hexazatetracyclo[16.6.1.14,8.022,25]hexacosa-2,5,7,18,20,22(25)-hexaene-13,24-dione |
| SMILES | COC1=C2CC(C=C1)/N=C\C1C(=O)Nc3ncnc(c31)N(C)CCN(C(C)C)C(=O)CCCO2 |
| InChI | InChI=1S/C24H32N6O4/c1-15(2)30-10-9-29(3)23-21-17(24(32)28-22(21)26-14-27-23)13-25-16-7-8-18(33-4)19(12-16)34-11-5-6-20(30)31/h7-8,13-17H,5-6,9-12H2,1-4H3,(H,26,27,28,32)/b25-13- |
| InChIKey | RBYXWSCJGBBRTF-MXAYSNPKSA-N |
| XLogP | 2.25 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |