C23H27ClN6O3 — CID 91319983
(12R)-15-chloro-17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,13,15-hexaene-8,23-dione (PubChem CID 91319983) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is (12R)-15-chloro-17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,13,15-hexaene-8,23-dione.
| Compound Name | (12R)-15-chloro-17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,13,15-hexaene-8,23-dione |
|---|---|
| PubChem CID | 91319983 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (12R)-15-chloro-17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,13,15-hexaene-8,23-dione |
| SMILES | O=C1Nc2ncnc3c2C1/C=N/[C@H]1C=CC(Cl)=C(C1)OCCCCCC(=O)N1CCN3CC1 |
| InChI | InChI=1S/C23H27ClN6O3/c24-17-6-5-15-12-18(17)33-11-3-1-2-4-19(31)29-7-9-30(10-8-29)22-20-16(13-25-15)23(32)28-21(20)26-14-27-22/h5-6,13-16H,1-4,7-12H2,(H,26,27,28,32)/b25-13+/t15-,16?/m0/s1 |
| InChIKey | REQPACBMLWEKAH-WXQHQWDDSA-N |
| XLogP | 2.60 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |