C18H19N3O4 — CID 91111495
3-[1-(furan-2-yl)propylideneamino]-4-(2-hydroxyanilino)-1-methylpyrrole-2,5-diol (PubChem CID 91111495) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)propylideneamino]-4-(2-hydroxyanilino)-1-methylpyrrole-2,5-diol.
| Compound Name | 3-[1-(furan-2-yl)propylideneamino]-4-(2-hydroxyanilino)-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91111495 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[1-(furan-2-yl)propylideneamino]-4-(2-hydroxyanilino)-1-methylpyrrole-2,5-diol |
| SMILES | CC/C(=N\c1c(Nc2ccccc2O)c(O)n(C)c1O)c1ccco1 |
| InChI | InChI=1S/C18H19N3O4/c1-3-11(14-9-6-10-25-14)19-15-16(18(24)21(2)17(15)23)20-12-7-4-5-8-13(12)22/h4-10,20,22-24H,3H2,1-2H3/b19-11+ |
| InChIKey | WPXMYBWRDLIQPC-YBFXNURJSA-N |
| XLogP | 4.01 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|