C14H17N5O4S — CID 135952621
ethyl N'-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-(furan-2-carbonyl)carbamimidothioate (PubChem CID 135952621) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is ethyl N'-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-(furan-2-carbonyl)carbamimidothioate.
| Compound Name | ethyl N'-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-(furan-2-carbonyl)carbamimidothioate |
|---|---|
| PubChem CID | 135952621 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | ethyl N'-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-N-(furan-2-carbonyl)carbamimidothioate |
| SMILES | CCS/C(=N\c1c(N)n(C)c(=O)n(C)c1=O)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H17N5O4S/c1-4-24-13(17-11(20)8-6-5-7-23-8)16-9-10(15)18(2)14(22)19(3)12(9)21/h5-7H,4,15H2,1-3H3,(H,16,17,20) |
| InChIKey | KZPYYBGFQBOAKY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|