C17H20ClN5O4 — CID 91113252
ethyl 6-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-2-methoxy-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 91113252) has the molecular formula C17H20ClN5O4 and a molecular weight of 393.83 g/mol. Its IUPAC name is ethyl 6-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-2-methoxy-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-2-methoxy-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91113252 |
| Molecular Formula | C17H20ClN5O4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | ethyl 6-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-2-methoxy-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1C(COCCN=[N+]=[N-])=NC(OC)=NC1c1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN5O4/c1-3-27-16(24)14-13(10-26-9-8-20-23-19)21-17(25-2)22-15(14)11-6-4-5-7-12(11)18/h4-7,14-15H,3,8-10H2,1-2H3 |
| InChIKey | PWLHAJLUXHVQNN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 118.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|