C17H19ClN4O3 — CID 59046560
(4R)-2-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 59046560) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is (4R)-2-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | (4R)-2-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59046560 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (4R)-2-(2-azidoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C)[C@@H](c2ccccc2Cl)C(C(=O)O)=C(COCCN=[N+]=[N-])N1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-10-11(2)21-14(9-25-8-7-20-22-19)16(17(23)24)15(10)12-5-3-4-6-13(12)18/h3-6,15,21H,7-9H2,1-2H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | GDAZLSJZHNUYHI-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|